C22H18BrNO8S — CID 126146287
3-[[2-bromo-4-[(E)-[3-(carboxymethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126146287) has the molecular formula C22H18BrNO8S and a molecular weight of 536.36 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(E)-[3-(carboxymethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-4-[(E)-[3-(carboxymethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126146287 |
| Molecular Formula | C22H18BrNO8S |
| Molecular Weight | 536.36 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | 3-[[2-bromo-4-[(E)-[3-(carboxymethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H18BrNO8S/c1-2-31-16-8-13(9-17-20(27)24(10-18(25)26)22(30)33-17)7-15(23)19(16)32-11-12-4-3-5-14(6-12)21(28)29/h3-9H,2,10-11H2,1H3,(H,25,26)(H,28,29)/b17-9+ |
| InChIKey | CIACAVJTUZEHBO-RQZCQDPDSA-N |
| XLogP | 4.25 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|