C23H20BrNO8S — CID 126064453
3-[[2-bromo-4-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126064453) has the molecular formula C23H20BrNO8S and a molecular weight of 550.38 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-4-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126064453 |
| Molecular Formula | C23H20BrNO8S |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | 3-[[2-bromo-4-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2cc(Br)c(OCc3cccc(C(=O)O)c3)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H20BrNO8S/c1-3-32-19(26)11-25-21(27)18(34-23(25)30)10-14-8-16(24)20(17(9-14)31-2)33-12-13-5-4-6-15(7-13)22(28)29/h4-10H,3,11-12H2,1-2H3,(H,28,29)/b18-10+ |
| InChIKey | QWYRUDXQSGORJX-VCHYOVAHSA-N |
| XLogP | 4.33 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|