C24H18BrNO6S — CID 126131626
2-[(5E)-5-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126131626) has the molecular formula C24H18BrNO6S and a molecular weight of 528.38 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126131626 |
| Molecular Formula | C24H18BrNO6S |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc(Br)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18BrNO6S/c1-31-19-10-15(11-20-23(29)26(12-21(27)28)24(30)33-20)9-18(25)22(19)32-13-14-6-7-16-4-2-3-5-17(16)8-14/h2-11H,12-13H2,1H3,(H,27,28)/b20-11+ |
| InChIKey | CWBZNLTZQSRCIW-RGVLZGJSSA-N |
| XLogP | 5.31 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|