C28H23BrN2O8S — CID 126247124
4-[[2-bromo-6-methoxy-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126247124) has the molecular formula C28H23BrN2O8S and a molecular weight of 627.47 g/mol. Its IUPAC name is 4-[[2-bromo-6-methoxy-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-methoxy-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126247124 |
| Molecular Formula | C28H23BrN2O8S |
| Molecular Weight | 627.47 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 4-[[2-bromo-6-methoxy-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccc(C(=O)O)cc4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H23BrN2O8S/c1-37-20-9-7-19(8-10-20)30-24(32)14-31-26(33)23(40-28(31)36)13-17-11-21(29)25(22(12-17)38-2)39-15-16-3-5-18(6-4-16)27(34)35/h3-13H,14-15H2,1-2H3,(H,30,32)(H,34,35)/b23-13+ |
| InChIKey | VPNBUQPKFWVNAO-YDZHTSKRSA-N |
| XLogP | 5.42 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|