C27H21BrN2O7S — CID 126171771
N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126171771) has the molecular formula C27H21BrN2O7S and a molecular weight of 597.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126171771 |
| Molecular Formula | C27H21BrN2O7S |
| Molecular Weight | 597.44 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H21BrN2O7S/c1-34-22-10-17(9-19(28)25(22)35-14-16-5-3-2-4-6-16)11-23-26(32)30(27(33)38-23)13-24(31)29-18-7-8-20-21(12-18)37-15-36-20/h2-12H,13-15H2,1H3,(H,29,31)/b23-11+ |
| InChIKey | YQAWCSLBXLXHCM-FOKLQQMPSA-N |
| XLogP | 5.44 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|