C30H25IN2O7S — CID 3488234
N-(1,3-benzodioxol-5-yl)-2-[5-[[4-[(4-iodophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3488234) has the molecular formula C30H25IN2O7S and a molecular weight of 684.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[5-[[4-[(4-iodophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[5-[[4-[(4-iodophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3488234 |
| Molecular Formula | C30H25IN2O7S |
| Molecular Weight | 684.51 g/mol |
| Exact Mass | 684.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[5-[[4-[(4-iodophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C=CCc1cc(C=C2SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc(OC)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C30H25IN2O7S/c1-3-4-20-11-19(12-25(37-2)28(20)38-16-18-5-7-21(31)8-6-18)13-26-29(35)33(30(36)41-26)15-27(34)32-22-9-10-23-24(14-22)40-17-39-23/h3,5-14H,1,4,15-17H2,2H3,(H,32,34) |
| InChIKey | UJHICHNWAWWOSM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|