C31H30N2O5S — CID 126279035
N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126279035) has the molecular formula C31H30N2O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126279035 |
| Molecular Formula | C31H30N2O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)Nc3cc(C)cc(C)c3)C2=O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C31H30N2O5S/c1-5-9-24-15-23(16-26(37-4)29(24)38-19-22-10-7-6-8-11-22)17-27-30(35)33(31(36)39-27)18-28(34)32-25-13-20(2)12-21(3)14-25/h5-8,10-17H,1,9,18-19H2,2-4H3,(H,32,34)/b27-17- |
| InChIKey | HTLZXFKRLQJBQL-PKAZHMFMSA-N |
| XLogP | 6.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|