C21H16Br2N2O7S — CID 126259378
2-[2,6-dibromo-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126259378) has the molecular formula C21H16Br2N2O7S and a molecular weight of 600.24 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126259378 |
| Molecular Formula | C21H16Br2N2O7S |
| Molecular Weight | 600.24 g/mol |
| Exact Mass | 597.90 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCC(=O)O)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H16Br2N2O7S/c1-31-13-4-2-12(3-5-13)24-17(26)9-25-20(29)16(33-21(25)30)8-11-6-14(22)19(15(23)7-11)32-10-18(27)28/h2-8H,9-10H2,1H3,(H,24,26)(H,27,28)/b16-8+ |
| InChIKey | YZQLOWXURANUHH-LZYBPNLTSA-N |
| XLogP | 4.36 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|