C30H22BrClN2O5S — CID 126238257
2-[(5E)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126238257) has the molecular formula C30H22BrClN2O5S and a molecular weight of 637.94 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126238257 |
| Molecular Formula | C30H22BrClN2O5S |
| Molecular Weight | 637.94 g/mol |
| Exact Mass | 636.01 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Cl)c(OCc4cccc5ccccc45)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H22BrClN2O5S/c1-38-22-11-9-21(10-12-22)33-27(35)16-34-29(36)26(40-30(34)37)15-18-13-24(31)28(25(32)14-18)39-17-20-7-4-6-19-5-2-3-8-23(19)20/h2-15H,16-17H2,1H3,(H,33,35)/b26-15+ |
| InChIKey | NUBYHPCTTWQEIH-CVKSISIWSA-N |
| XLogP | 7.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.94 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|