C33H26BrClN2O7S — CID 126163740
methyl 5-[[2-[(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126163740) has the molecular formula C33H26BrClN2O7S and a molecular weight of 710.00 g/mol. Its IUPAC name is methyl 5-[[2-[(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[2-[(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126163740 |
| Molecular Formula | C33H26BrClN2O7S |
| Molecular Weight | 710.00 g/mol |
| Exact Mass | 708.03 |
| IUPAC Name | methyl 5-[[2-[(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OC)c3)C2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C33H26BrClN2O7S/c1-3-43-27-14-19(13-25(34)30(27)44-18-21-9-6-8-20-7-4-5-10-23(20)21)15-28-31(39)37(33(41)45-28)17-29(38)36-22-11-12-26(35)24(16-22)32(40)42-2/h4-16H,3,17-18H2,1-2H3,(H,36,38)/b28-15+ |
| InChIKey | QWCQXPCMCUFQIR-RWPZCVJISA-N |
| XLogP | 7.70 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.00 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|