C32H25ClN2O7S — CID 126170922
methyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126170922) has the molecular formula C32H25ClN2O7S and a molecular weight of 617.08 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126170922 |
| Molecular Formula | C32H25ClN2O7S |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCc4cccc5ccccc45)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C32H25ClN2O7S/c1-40-27-14-19(10-13-26(27)42-18-21-8-5-7-20-6-3-4-9-23(20)21)15-28-30(37)35(32(39)43-28)17-29(36)34-22-11-12-25(33)24(16-22)31(38)41-2/h3-16H,17-18H2,1-2H3,(H,34,36)/b28-15+ |
| InChIKey | LJTPQGNZTIMVCK-RWPZCVJISA-N |
| XLogP | 6.54 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|