C30H25Cl3N2O7S — CID 126170353
propyl 2-chloro-5-[[2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126170353) has the molecular formula C30H25Cl3N2O7S and a molecular weight of 663.96 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126170353 |
| Molecular Formula | C30H25Cl3N2O7S |
| Molecular Weight | 663.96 g/mol |
| Exact Mass | 662.04 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCc4ccc(Cl)cc4Cl)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H25Cl3N2O7S/c1-3-10-41-29(38)21-14-20(7-8-22(21)32)34-27(36)15-35-28(37)26(43-30(35)39)12-17-4-9-24(25(11-17)40-2)42-16-18-5-6-19(31)13-23(18)33/h4-9,11-14H,3,10,15-16H2,1-2H3,(H,34,36)/b26-12+ |
| InChIKey | CDOWZPCYQRXSTM-RPPGKUMJSA-N |
| XLogP | 7.48 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.96 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|