C23H20BrClN2O6S — CID 126164333
propyl 5-[[2-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126164333) has the molecular formula C23H20BrClN2O6S and a molecular weight of 567.85 g/mol. Its IUPAC name is propyl 5-[[2-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | propyl 5-[[2-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126164333 |
| Molecular Formula | C23H20BrClN2O6S |
| Molecular Weight | 567.85 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | propyl 5-[[2-[(5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OC)c(Br)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H20BrClN2O6S/c1-3-8-33-22(30)15-11-14(5-6-17(15)25)26-20(28)12-27-21(29)19(34-23(27)31)10-13-4-7-18(32-2)16(24)9-13/h4-7,9-11H,3,8,12H2,1-2H3,(H,26,28)/b19-10+ |
| InChIKey | XCJKINNMWIVGNB-VXLYETTFSA-N |
| XLogP | 5.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|