C23H20ClN3O8S — CID 126159738
propyl 2-chloro-5-[[2-[(5E)-5-[(4-methoxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126159738) has the molecular formula C23H20ClN3O8S and a molecular weight of 533.95 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[(4-methoxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[(4-methoxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126159738 |
| Molecular Formula | C23H20ClN3O8S |
| Molecular Weight | 533.95 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[(4-methoxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OC)c([N+](=O)[O-])c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H20ClN3O8S/c1-3-8-35-22(30)15-11-14(5-6-16(15)24)25-20(28)12-26-21(29)19(36-23(26)31)10-13-4-7-18(34-2)17(9-13)27(32)33/h4-7,9-11H,3,8,12H2,1-2H3,(H,25,28)/b19-10+ |
| InChIKey | LTXJHBOTCYWVEN-VXLYETTFSA-N |
| XLogP | 4.50 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|