C23H18ClN3O9S — CID 126362764
propyl 2-chloro-5-[[2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126362764) has the molecular formula C23H18ClN3O9S and a molecular weight of 547.93 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126362764 |
| Molecular Formula | C23H18ClN3O9S |
| Molecular Weight | 547.93 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc4c(cc3[N+](=O)[O-])OCO4)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H18ClN3O9S/c1-2-5-34-22(30)14-8-13(3-4-15(14)24)25-20(28)10-26-21(29)19(37-23(26)31)7-12-6-17-18(36-11-35-17)9-16(12)27(32)33/h3-4,6-9H,2,5,10-11H2,1H3,(H,25,28)/b19-7- |
| InChIKey | IZOPUIMHZAVKDT-GXHLCREISA-N |
| XLogP | 4.22 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.93 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|