C21H17N3O7S — CID 126358769
N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126358769) has the molecular formula C21H17N3O7S and a molecular weight of 455.45 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126358769 |
| Molecular Formula | C21H17N3O7S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CN2C(=O)S/C(=C\c3cc4c(cc3[N+](=O)[O-])OCO4)C2=O)c1 |
| InChI | InChI=1S/C21H17N3O7S/c1-11-3-12(2)5-14(4-11)22-19(25)9-23-20(26)18(32-21(23)27)7-13-6-16-17(31-10-30-16)8-15(13)24(28)29/h3-8H,9-10H2,1-2H3,(H,22,25)/b18-7- |
| InChIKey | HMHSBMPHUUXODQ-WSVATBPTSA-N |
| XLogP | 3.62 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|