C20H16N4O7 — CID 126024896
N-(4-methylphenyl)-2-[(4Z)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126024896) has the molecular formula C20H16N4O7 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(4Z)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(4Z)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126024896 |
| Molecular Formula | C20H16N4O7 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-(4-methylphenyl)-2-[(4Z)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N/C(=C\c3cc4c(cc3[N+](=O)[O-])OCO4)C2=O)cc1 |
| InChI | InChI=1S/C20H16N4O7/c1-11-2-4-13(5-3-11)21-18(25)9-23-19(26)14(22-20(23)27)6-12-7-16-17(31-10-30-16)8-15(12)24(28)29/h2-8H,9-10H2,1H3,(H,21,25)(H,22,27)/b14-6- |
| InChIKey | KUDYBPINGWARPR-NSIKDUERSA-N |
| XLogP | 2.16 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|