C26H19F3N4O6 — CID 3787227
N-(4-methylphenyl)-2-[4-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 3787227) has the molecular formula C26H19F3N4O6 and a molecular weight of 540.45 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 3787227 |
| Molecular Formula | C26H19F3N4O6 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(=Cc3ccc(Oc4ccc(C(F)(F)F)cc4[N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H19F3N4O6/c1-15-2-7-18(8-3-15)30-23(34)14-32-24(35)20(31-25(32)36)12-16-4-9-19(10-5-16)39-22-11-6-17(26(27,28)29)13-21(22)33(37)38/h2-13H,14H2,1H3,(H,30,34)(H,31,36) |
| InChIKey | YMRIKOGCORGUBH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|