C19H14F3N3O4 — CID 167885181
2-[(4E)-4-[(4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 167885181) has the molecular formula C19H14F3N3O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4E)-4-[(4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 167885181 |
| Molecular Formula | C19H14F3N3O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[(4E)-4-[(4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2ccc(O)cc2)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N3O4/c20-19(21,22)12-2-1-3-13(9-12)23-16(27)10-25-17(28)15(24-18(25)29)8-11-4-6-14(26)7-5-11/h1-9,26H,10H2,(H,23,27)(H,24,29)/b15-8+ |
| InChIKey | HAROHLJRBFZHTB-OVCLIPMQSA-N |
| XLogP | 2.94 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|