C25H18F3N3O3 — CID 18873952
4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 18873952) has the molecular formula C25H18F3N3O3 and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18873952 |
| Molecular Formula | C25H18F3N3O3 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(CN2C(=O)N/C(=C\c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H18F3N3O3/c26-25(27,28)19-7-4-8-20(14-19)29-22(32)18-11-9-17(10-12-18)15-31-23(33)21(30-24(31)34)13-16-5-2-1-3-6-16/h1-14H,15H2,(H,29,32)(H,30,34)/b21-13- |
| InChIKey | BXVPSTNACPYERL-BKUYFWCQSA-N |
| XLogP | 5.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|