C24H18FN3O3 — CID 18873943
4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-(4-fluorophenyl)benzamide (PubChem CID 18873943) has the molecular formula C24H18FN3O3 and a molecular weight of 415.42 g/mol. Its IUPAC name is 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 18873943 |
| Molecular Formula | C24H18FN3O3 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[[(4Z)-4-benzylidene-2,5-dioxoimidazolidin-1-yl]methyl]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(CN2C(=O)N/C(=C\c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H18FN3O3/c25-19-10-12-20(13-11-19)26-22(29)18-8-6-17(7-9-18)15-28-23(30)21(27-24(28)31)14-16-4-2-1-3-5-16/h1-14H,15H2,(H,26,29)(H,27,31)/b21-14- |
| InChIKey | FFBMQNCXAFQPCN-STZFKDTASA-N |
| XLogP | 4.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|