C18H14ClN3O3 — CID 19256098
2-[(4Z)-4-[(4-chlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 19256098) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 19256098 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)N/C(=C\c2ccc(Cl)cc2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H14ClN3O3/c19-13-8-6-12(7-9-13)10-15-17(24)22(18(25)21-15)11-16(23)20-14-4-2-1-3-5-14/h1-10H,11H2,(H,20,23)(H,21,25)/b15-10- |
| InChIKey | VPRCKKDSGZORQM-GDNBJRDFSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|