C22H16ClN3O3S2 — CID 3725262
2-[4-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 3725262) has the molecular formula C22H16ClN3O3S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 2-[4-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3725262 |
| Molecular Formula | C22H16ClN3O3S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-[4-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)NC(=Cc2ccc(Sc3ccc(Cl)cc3)s2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H16ClN3O3S2/c23-14-6-8-16(9-7-14)30-20-11-10-17(31-20)12-18-21(28)26(22(29)25-18)13-19(27)24-15-4-2-1-3-5-15/h1-12H,13H2,(H,24,27)(H,25,29) |
| InChIKey | IEQBYVCGKXKUDO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|