C23H20N4O3 — CID 50856585
2-[(4Z)-4-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 50856585) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[(4Z)-4-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4Z)-4-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 50856585 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[(4Z)-4-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(/C=C2\NC(=O)N(CC(=O)Nc3ccccc3)C2=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O3/c1-16-12-13-19(27(16)18-10-6-3-7-11-18)14-20-22(29)26(23(30)25-20)15-21(28)24-17-8-4-2-5-9-17/h2-14H,15H2,1H3,(H,24,28)(H,25,30)/b20-14- |
| InChIKey | FSAABBSBWHYHTM-ZHZULCJRSA-N |
| XLogP | 3.32 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|