C23H18ClN3O4S — CID 3795061
2-[4-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 3795061) has the molecular formula C23H18ClN3O4S and a molecular weight of 467.93 g/mol. Its IUPAC name is 2-[4-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3795061 |
| Molecular Formula | C23H18ClN3O4S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-[4-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(=Cc3ccc(Sc4ccc(Cl)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C23H18ClN3O4S/c1-14-2-6-16(7-3-14)25-20(28)13-27-22(29)19(26-23(27)30)12-17-8-11-21(31-17)32-18-9-4-15(24)5-10-18/h2-12H,13H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | DNSJVERTYQFBEO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|