C26H24N2O4S2 — CID 126354455
2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 126354455) has the molecular formula C26H24N2O4S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126354455 |
| Molecular Formula | C26H24N2O4S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1ccc(Sc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4ccc(C(C)C)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C26H24N2O4S2/c1-16(2)18-6-8-19(9-7-18)27-23(29)15-28-25(30)22(34-26(28)31)14-20-10-13-24(32-20)33-21-11-4-17(3)5-12-21/h4-14,16H,15H2,1-3H3,(H,27,29)/b22-14- |
| InChIKey | NVFGTQIQZBTBKU-HMAPJEAMSA-N |
| XLogP | 6.54 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|