C23H17FN2O4S2 — CID 126176122
N-(4-fluorophenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126176122) has the molecular formula C23H17FN2O4S2 and a molecular weight of 468.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126176122 |
| Molecular Formula | C23H17FN2O4S2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Sc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C23H17FN2O4S2/c1-14-2-9-18(10-3-14)31-21-11-8-17(30-21)12-19-22(28)26(23(29)32-19)13-20(27)25-16-6-4-15(24)5-7-16/h2-12H,13H2,1H3,(H,25,27)/b19-12- |
| InChIKey | SEDZTAOCHSPLLL-UNOMPAQXSA-N |
| XLogP | 5.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|