C24H19ClN2O5S2 — CID 126112931
2-[(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126112931) has the molecular formula C24H19ClN2O5S2 and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126112931 |
| Molecular Formula | C24H19ClN2O5S2 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(Sc4ccc(Cl)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C24H19ClN2O5S2/c1-2-31-17-7-5-16(6-8-17)26-21(28)14-27-23(29)20(34-24(27)30)13-18-9-12-22(32-18)33-19-10-3-15(25)4-11-19/h3-13H,2,14H2,1H3,(H,26,28)/b20-13+ |
| InChIKey | OEUNFKOGLJGHQR-DEDYPNTBSA-N |
| XLogP | 6.16 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|