C25H22N2O4S2 — CID 126347713
N-(3,5-dimethylphenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126347713) has the molecular formula C25H22N2O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126347713 |
| Molecular Formula | C25H22N2O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Sc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4cc(C)cc(C)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H22N2O4S2/c1-15-4-7-20(8-5-15)32-23-9-6-19(31-23)13-21-24(29)27(25(30)33-21)14-22(28)26-18-11-16(2)10-17(3)12-18/h4-13H,14H2,1-3H3,(H,26,28)/b21-13- |
| InChIKey | FTKSDBLRXRSVCF-BKUYFWCQSA-N |
| XLogP | 6.03 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|