C23H16Cl2N2O5S2 — CID 126280693
N-(3-chloro-4-methoxyphenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126280693) has the molecular formula C23H16Cl2N2O5S2 and a molecular weight of 535.43 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126280693 |
| Molecular Formula | C23H16Cl2N2O5S2 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(Sc4ccc(Cl)cc4)o3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H16Cl2N2O5S2/c1-31-18-8-4-14(10-17(18)25)26-20(28)12-27-22(29)19(34-23(27)30)11-15-5-9-21(32-15)33-16-6-2-13(24)3-7-16/h2-11H,12H2,1H3,(H,26,28)/b19-11- |
| InChIKey | PDBVQJFPWIGMRX-ODLFYWEKSA-N |
| XLogP | 6.42 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|