C25H19ClN2O6S2 — CID 126159273
methyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126159273) has the molecular formula C25H19ClN2O6S2 and a molecular weight of 543.02 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126159273 |
| Molecular Formula | C25H19ClN2O6S2 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(Sc4ccc(C)cc4)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C25H19ClN2O6S2/c1-14-3-7-17(8-4-14)35-22-10-6-16(34-22)12-20-23(30)28(25(32)36-20)13-21(29)27-15-5-9-19(26)18(11-15)24(31)33-2/h3-12H,13H2,1-2H3,(H,27,29)/b20-12- |
| InChIKey | CHQJMOBGNHQXAU-NDENLUEZSA-N |
| XLogP | 5.85 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|