C24H16ClFN2O6S — CID 126159065
methyl 2-chloro-5-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126159065) has the molecular formula C24H16ClFN2O6S and a molecular weight of 514.92 g/mol. Its IUPAC name is methyl 2-chloro-5-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126159065 |
| Molecular Formula | C24H16ClFN2O6S |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | methyl 2-chloro-5-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C24H16ClFN2O6S/c1-33-23(31)17-10-13(2-8-18(17)25)19-9-7-16(34-19)11-20-22(30)28(24(32)35-20)12-21(29)27-15-5-3-14(26)4-6-15/h2-11H,12H2,1H3,(H,27,29)/b20-11+ |
| InChIKey | GIOHOWGRRVRSIH-RGVLZGJSSA-N |
| XLogP | 5.20 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|