C26H18ClF3N2O6S — CID 126159584
ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126159584) has the molecular formula C26H18ClF3N2O6S and a molecular weight of 578.95 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126159584 |
| Molecular Formula | C26H18ClF3N2O6S |
| Molecular Weight | 578.95 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cccc(C(F)(F)F)c4)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H18ClF3N2O6S/c1-2-37-24(35)18-11-16(6-8-19(18)27)31-22(33)13-32-23(34)21(39-25(32)36)12-17-7-9-20(38-17)14-4-3-5-15(10-14)26(28,29)30/h3-12H,2,13H2,1H3,(H,31,33)/b21-12+ |
| InChIKey | HQUNQFZXXWRURC-CIAFOILYSA-N |
| XLogP | 6.47 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.95 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|