C27H21ClN2O8S — CID 126166006
3-[5-[(Z)-[3-[2-(4-chloro-3-ethoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid (PubChem CID 126166006) has the molecular formula C27H21ClN2O8S and a molecular weight of 568.99 g/mol. Its IUPAC name is 3-[5-[(Z)-[3-[2-(4-chloro-3-ethoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-[(Z)-[3-[2-(4-chloro-3-ethoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 126166006 |
| Molecular Formula | C27H21ClN2O8S |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 3-[5-[(Z)-[3-[2-(4-chloro-3-ethoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(-c4cc(C(=O)O)ccc4C)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H21ClN2O8S/c1-3-37-26(35)19-11-16(6-8-20(19)28)29-23(31)13-30-24(32)22(39-27(30)36)12-17-7-9-21(38-17)18-10-15(25(33)34)5-4-14(18)2/h4-12H,3,13H2,1-2H3,(H,29,31)(H,33,34)/b22-12- |
| InChIKey | WROIARQEBJZLEP-UUYOSTAYSA-N |
| XLogP | 5.46 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|