C27H21Cl2N3O8S — CID 126166280
butyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126166280) has the molecular formula C27H21Cl2N3O8S and a molecular weight of 618.45 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126166280 |
| Molecular Formula | C27H21Cl2N3O8S |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc(Cl)cc4[N+](=O)[O-])o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H21Cl2N3O8S/c1-2-3-10-39-26(35)19-12-16(5-8-20(19)29)30-24(33)14-31-25(34)23(41-27(31)36)13-17-6-9-22(40-17)18-7-4-15(28)11-21(18)32(37)38/h4-9,11-13H,2-3,10,14H2,1H3,(H,30,33)/b23-13+ |
| InChIKey | OVQQLZWXKLWUIH-YDZHTSKRSA-N |
| XLogP | 6.79 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|