C24H15BrClN3O8S — CID 126157571
methyl 5-[[2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126157571) has the molecular formula C24H15BrClN3O8S and a molecular weight of 620.82 g/mol. Its IUPAC name is methyl 5-[[2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126157571 |
| Molecular Formula | C24H15BrClN3O8S |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 618.95 |
| IUPAC Name | methyl 5-[[2-[(5E)-5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc([N+](=O)[O-])cc4Br)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C24H15BrClN3O8S/c1-36-23(32)16-8-12(2-6-18(16)26)27-21(30)11-28-22(31)20(38-24(28)33)10-14-4-7-19(37-14)15-5-3-13(29(34)35)9-17(15)25/h2-10H,11H2,1H3,(H,27,30)/b20-10+ |
| InChIKey | AXOSTJBKXXTVQT-KEBDBYFISA-N |
| XLogP | 5.73 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|