C26H19Cl2N3O8S — CID 126160663
propyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126160663) has the molecular formula C26H19Cl2N3O8S and a molecular weight of 604.42 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126160663 |
| Molecular Formula | C26H19Cl2N3O8S |
| Molecular Weight | 604.42 g/mol |
| Exact Mass | 603.03 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc(Cl)cc4[N+](=O)[O-])o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H19Cl2N3O8S/c1-2-9-38-25(34)18-11-15(4-7-19(18)28)29-23(32)13-30-24(33)22(40-26(30)35)12-16-5-8-21(39-16)17-6-3-14(27)10-20(17)31(36)37/h3-8,10-12H,2,9,13H2,1H3,(H,29,32)/b22-12+ |
| InChIKey | NXDBNSYUCYAMBB-WSDLNYQXSA-N |
| XLogP | 6.40 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|