C27H20ClF3N2O6S — CID 126171741
propyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126171741) has the molecular formula C27H20ClF3N2O6S and a molecular weight of 592.98 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126171741 |
| Molecular Formula | C27H20ClF3N2O6S |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cccc(C(F)(F)F)c4)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C27H20ClF3N2O6S/c1-2-10-38-25(36)19-12-17(6-8-20(19)28)32-23(34)14-33-24(35)22(40-26(33)37)13-18-7-9-21(39-18)15-4-3-5-16(11-15)27(29,30)31/h3-9,11-13H,2,10,14H2,1H3,(H,32,34)/b22-13+ |
| InChIKey | YLVAIRRLUZICAZ-LPYMAVHISA-N |
| XLogP | 6.86 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|