C24H17F3N2O4S2 — CID 126179534
2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 126179534) has the molecular formula C24H17F3N2O4S2 and a molecular weight of 518.54 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126179534 |
| Molecular Formula | C24H17F3N2O4S2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cccc(C(F)(F)F)c4)o3)C2=O)c1 |
| InChI | InChI=1S/C24H17F3N2O4S2/c1-34-18-7-3-6-16(11-18)28-21(30)13-29-22(31)20(35-23(29)32)12-17-8-9-19(33-17)14-4-2-5-15(10-14)24(25,26)27/h2-12H,13H2,1H3,(H,28,30)/b20-12+ |
| InChIKey | HYRMTIPTVLXJCQ-UDWIEESQSA-N |
| XLogP | 6.36 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|