C22H16N2O4S — CID 6281902
2-[(5Z)-2,4-dioxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]-N-phenylacetamide (PubChem CID 6281902) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 6281902 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazolidin-3-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3ccccc3)o2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-20(23-16-9-5-2-6-10-16)14-24-21(26)19(29-22(24)27)13-17-11-12-18(28-17)15-7-3-1-4-8-15/h1-13H,14H2,(H,23,25)/b19-13- |
| InChIKey | FVGJBTBCOSHWJO-UYRXBGFRSA-N |
| XLogP | 4.62 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|