C22H14Br2N2O4S — CID 126165977
N-(4-bromophenyl)-2-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126165977) has the molecular formula C22H14Br2N2O4S and a molecular weight of 562.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126165977 |
| Molecular Formula | C22H14Br2N2O4S |
| Molecular Weight | 562.24 g/mol |
| Exact Mass | 559.90 |
| IUPAC Name | N-(4-bromophenyl)-2-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccc(Br)cc3)o2)C1=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14Br2N2O4S/c23-14-3-1-13(2-4-14)18-10-9-17(30-18)11-19-21(28)26(22(29)31-19)12-20(27)25-16-7-5-15(24)6-8-16/h1-11H,12H2,(H,25,27)/b19-11+ |
| InChIKey | RXAOLNDUTPJNME-YBFXNURJSA-N |
| XLogP | 6.15 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.24 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|