C23H17N3O6S — CID 1329703
N-(4-methylphenyl)-2-[5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 1329703) has the molecular formula C23H17N3O6S and a molecular weight of 463.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 1329703 |
| Molecular Formula | C23H17N3O6S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-(4-methylphenyl)-2-[5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)SC(=Cc3ccc(-c4ccc([N+](=O)[O-])cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O6S/c1-14-2-6-16(7-3-14)24-21(27)13-25-22(28)20(33-23(25)29)12-18-10-11-19(32-18)15-4-8-17(9-5-15)26(30)31/h2-12H,13H2,1H3,(H,24,27) |
| InChIKey | UTQHTPSDPWVJCR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|