C24H16ClN3O8S — CID 126160491
methyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126160491) has the molecular formula C24H16ClN3O8S and a molecular weight of 541.93 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126160491 |
| Molecular Formula | C24H16ClN3O8S |
| Molecular Weight | 541.93 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C24H16ClN3O8S/c1-35-23(31)17-10-14(4-8-18(17)25)26-21(29)12-27-22(30)20(37-24(27)32)11-16-7-9-19(36-16)13-2-5-15(6-3-13)28(33)34/h2-11H,12H2,1H3,(H,26,29)/b20-11+ |
| InChIKey | KASPRZNYXCOESL-RGVLZGJSSA-N |
| XLogP | 4.97 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|