C26H19ClN2O8S — CID 6514402
3-[5-[(E)-[3-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 6514402) has the molecular formula C26H19ClN2O8S and a molecular weight of 554.96 g/mol. Its IUPAC name is 3-[5-[(E)-[3-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-[3-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 6514402 |
| Molecular Formula | C26H19ClN2O8S |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 3-[5-[(E)-[3-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cccc(C(=O)O)c4C)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H19ClN2O8S/c1-13-16(4-3-5-17(13)24(32)33)20-9-7-15(37-20)11-21-23(31)29(26(35)38-21)12-22(30)28-14-6-8-19(27)18(10-14)25(34)36-2/h3-11H,12H2,1-2H3,(H,28,30)(H,32,33)/b21-11+ |
| InChIKey | FXMIRDIYCACNMT-SRZZPIQSSA-N |
| XLogP | 5.07 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|