C26H22N2O7S — CID 22306747
3-[5-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 22306747) has the molecular formula C26H22N2O7S and a molecular weight of 506.54 g/mol. Its IUPAC name is 3-[5-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 22306747 |
| Molecular Formula | C26H22N2O7S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 3-[5-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(-c4cccc(C(=O)O)c4C)o3)C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O7S/c1-3-34-17-9-7-16(8-10-17)27-23(29)14-28-24(30)22(36-26(28)33)13-18-11-12-21(35-18)19-5-4-6-20(15(19)2)25(31)32/h4-13H,3,14H2,1-2H3,(H,27,29)(H,31,32)/b22-13- |
| InChIKey | GBKUCABAOJPESI-XKZIYDEJSA-N |
| XLogP | 5.03 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|