C25H19N3O5S — CID 5453228
2-[(5E)-5-[[5-(4-cyanophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 5453228) has the molecular formula C25H19N3O5S and a molecular weight of 473.51 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-cyanophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(4-cyanophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5453228 |
| Molecular Formula | C25H19N3O5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-cyanophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc(C#N)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C25H19N3O5S/c1-2-32-19-9-7-18(8-10-19)27-23(29)15-28-24(30)22(34-25(28)31)13-20-11-12-21(33-20)17-5-3-16(14-26)4-6-17/h3-13H,2,15H2,1H3,(H,27,29)/b22-13+ |
| InChIKey | MEMVGLZHGPFOAA-LPYMAVHISA-N |
| XLogP | 4.89 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|