C24H17FN2O6S — CID 126175585
methyl 4-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126175585) has the molecular formula C24H17FN2O6S and a molecular weight of 480.47 g/mol. Its IUPAC name is methyl 4-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126175585 |
| Molecular Formula | C24H17FN2O6S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | methyl 4-[5-[(E)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H17FN2O6S/c1-32-23(30)15-4-2-14(3-5-15)19-11-10-18(33-19)12-20-22(29)27(24(31)34-20)13-21(28)26-17-8-6-16(25)7-9-17/h2-12H,13H2,1H3,(H,26,28)/b20-12+ |
| InChIKey | PHVNBMFRQMVPTP-UDWIEESQSA-N |
| XLogP | 4.55 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|