C24H19ClN2O4S — CID 5219110
2-[5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 5219110) has the molecular formula C24H19ClN2O4S and a molecular weight of 466.95 g/mol. Its IUPAC name is 2-[5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 5219110 |
| Molecular Formula | C24H19ClN2O4S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-[5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)SC(=Cc3ccc(-c4cccc(Cl)c4)o3)C2=O)cc1C |
| InChI | InChI=1S/C24H19ClN2O4S/c1-14-6-7-18(10-15(14)2)26-22(28)13-27-23(29)21(32-24(27)30)12-19-8-9-20(31-19)16-4-3-5-17(25)11-16/h3-12H,13H2,1-2H3,(H,26,28) |
| InChIKey | MOOZFZRRNHJWQL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|