C24H18Cl2N2O4S — CID 126180963
2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126180963) has the molecular formula C24H18Cl2N2O4S and a molecular weight of 501.39 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126180963 |
| Molecular Formula | C24H18Cl2N2O4S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4ccc(Cl)cc4Cl)o3)C2=O)cc1C |
| InChI | InChI=1S/C24H18Cl2N2O4S/c1-13-3-5-16(9-14(13)2)27-22(29)12-28-23(30)21(33-24(28)31)11-17-6-8-20(32-17)18-7-4-15(25)10-19(18)26/h3-11H,12H2,1-2H3,(H,27,29)/b21-11+ |
| InChIKey | NWNLRXXHFLOVMQ-SRZZPIQSSA-N |
| XLogP | 6.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|