C22H12Cl3FN2O4S — CID 126229301
N-(3-chloro-4-fluorophenyl)-2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126229301) has the molecular formula C22H12Cl3FN2O4S and a molecular weight of 525.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126229301 |
| Molecular Formula | C22H12Cl3FN2O4S |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[(5E)-5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)C1=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H12Cl3FN2O4S/c23-11-1-4-14(15(24)7-11)18-6-3-13(32-18)9-19-21(30)28(22(31)33-19)10-20(29)27-12-2-5-17(26)16(25)8-12/h1-9H,10H2,(H,27,29)/b19-9+ |
| InChIKey | GSQYGOXXHTZQLM-DJKKODMXSA-N |
| XLogP | 6.72 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|